C10H13ClF3NO2 — CID 171222254
2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-methoxyphenol;hydrochloride (PubChem CID 171222254) has the molecular formula C10H13ClF3NO2 and a molecular weight of 271.67 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-methoxyphenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171222254 |
| Molecular Formula | C10H13ClF3NO2 |
| Molecular Weight | 271.67 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-methoxyphenol;hydrochloride |
| SMILES | COc1ccc(O)c([C@@H](N)CC(F)(F)F)c1.Cl |
| InChI | InChI=1S/C10H12F3NO2.ClH/c1-16-6-2-3-9(15)7(4-6)8(14)5-10(11,12)13;/h2-4,8,15H,5,14H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | ZZYCJTDPRRSYDS-QRPNPIFTSA-N |
| XLogP | 2.77 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|