C12H20N2O2 — CID 171222237
2-[(1S)-1,5-diaminopentyl]-4-methoxyphenol (PubChem CID 171222237) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-[(1S)-1,5-diaminopentyl]-4-methoxyphenol.
| Compound Name | 2-[(1S)-1,5-diaminopentyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 171222237 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-[(1S)-1,5-diaminopentyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c([C@@H](N)CCCCN)c1 |
| InChI | InChI=1S/C12H20N2O2/c1-16-9-5-6-12(15)10(8-9)11(14)4-2-3-7-13/h5-6,8,11,15H,2-4,7,13-14H2,1H3/t11-/m0/s1 |
| InChIKey | VGBXHPWZPKRONE-NSHDSACASA-N |
| XLogP | 1.53 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|