C9H10F2N2O3 — CID 171312782
2-[(1S)-1-amino-3,3-difluoropropyl]-4-nitrophenol (PubChem CID 171312782) has the molecular formula C9H10F2N2O3 and a molecular weight of 232.19 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3,3-difluoropropyl]-4-nitrophenol.
| Compound Name | 2-[(1S)-1-amino-3,3-difluoropropyl]-4-nitrophenol |
|---|---|
| PubChem CID | 171312782 |
| Molecular Formula | C9H10F2N2O3 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-[(1S)-1-amino-3,3-difluoropropyl]-4-nitrophenol |
| SMILES | N[C@@H](CC(F)F)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C9H10F2N2O3/c10-9(11)4-7(12)6-3-5(13(15)16)1-2-8(6)14/h1-3,7,9,14H,4,12H2/t7-/m0/s1 |
| InChIKey | UBZCCNZFASVFMK-ZETCQYMHSA-N |
| XLogP | 1.96 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|