C9H11ClF2N2O3 — CID 171312862
4-[(1S)-1-amino-3,3-difluoropropyl]-2-nitrophenol;hydrochloride (PubChem CID 171312862) has the molecular formula C9H11ClF2N2O3 and a molecular weight of 268.65 g/mol. Its IUPAC name is 4-[(1S)-1-amino-3,3-difluoropropyl]-2-nitrophenol;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-3,3-difluoropropyl]-2-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171312862 |
| Molecular Formula | C9H11ClF2N2O3 |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 4-[(1S)-1-amino-3,3-difluoropropyl]-2-nitrophenol;hydrochloride |
| SMILES | Cl.N[C@@H](CC(F)F)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10F2N2O3.ClH/c10-9(11)4-6(12)5-1-2-8(14)7(3-5)13(15)16;/h1-3,6,9,14H,4,12H2;1H/t6-;/m0./s1 |
| InChIKey | CGQCZZMLEWATOP-RGMNGODLSA-N |
| XLogP | 2.38 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|