C11H15ClN2O3 — CID 171199963
4-[(1R)-1-amino-3-methylbut-3-enyl]-2-nitrophenol;hydrochloride (PubChem CID 171199963) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.71 g/mol. Its IUPAC name is 4-[(1R)-1-amino-3-methylbut-3-enyl]-2-nitrophenol;hydrochloride.
| Compound Name | 4-[(1R)-1-amino-3-methylbut-3-enyl]-2-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171199963 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-[(1R)-1-amino-3-methylbut-3-enyl]-2-nitrophenol;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1ccc(O)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C11H14N2O3.ClH/c1-7(2)5-9(12)8-3-4-11(14)10(6-8)13(15)16;/h3-4,6,9,14H,1,5,12H2,2H3;1H/t9-;/m1./s1 |
| InChIKey | MDROZTIEQJLLAG-SBSPUUFOSA-N |
| XLogP | 2.69 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|