C10H12ClF3N2O3 — CID 171219475
4-[(1S)-1-amino-4,4,4-trifluorobutyl]-2-nitrophenol;hydrochloride (PubChem CID 171219475) has the molecular formula C10H12ClF3N2O3 and a molecular weight of 300.66 g/mol. Its IUPAC name is 4-[(1S)-1-amino-4,4,4-trifluorobutyl]-2-nitrophenol;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-4,4,4-trifluorobutyl]-2-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171219475 |
| Molecular Formula | C10H12ClF3N2O3 |
| Molecular Weight | 300.66 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 4-[(1S)-1-amino-4,4,4-trifluorobutyl]-2-nitrophenol;hydrochloride |
| SMILES | Cl.N[C@@H](CCC(F)(F)F)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11F3N2O3.ClH/c11-10(12,13)4-3-7(14)6-1-2-9(16)8(5-6)15(17)18;/h1-2,5,7,16H,3-4,14H2;1H/t7-;/m0./s1 |
| InChIKey | WCQXVLSZDYBCGV-FJXQXJEOSA-N |
| XLogP | 3.06 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.66 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|