C10H12ClF3N2O2 — CID 171198257
(1R)-4,4,4-trifluoro-1-(4-nitrophenyl)butan-1-amine;hydrochloride (PubChem CID 171198257) has the molecular formula C10H12ClF3N2O2 and a molecular weight of 284.67 g/mol. Its IUPAC name is (1R)-4,4,4-trifluoro-1-(4-nitrophenyl)butan-1-amine;hydrochloride.
| Compound Name | (1R)-4,4,4-trifluoro-1-(4-nitrophenyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171198257 |
| Molecular Formula | C10H12ClF3N2O2 |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (1R)-4,4,4-trifluoro-1-(4-nitrophenyl)butan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](CCC(F)(F)F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H11F3N2O2.ClH/c11-10(12,13)6-5-9(14)7-1-3-8(4-2-7)15(16)17;/h1-4,9H,5-6,14H2;1H/t9-;/m1./s1 |
| InChIKey | QSFVEHIRPMATEG-SBSPUUFOSA-N |
| XLogP | 3.36 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|