C8H10ClF3N2O2S — CID 171216694
(1R)-4,4,4-trifluoro-1-(5-nitrothiophen-3-yl)butan-1-amine;hydrochloride (PubChem CID 171216694) has the molecular formula C8H10ClF3N2O2S and a molecular weight of 290.69 g/mol. Its IUPAC name is (1R)-4,4,4-trifluoro-1-(5-nitrothiophen-3-yl)butan-1-amine;hydrochloride.
| Compound Name | (1R)-4,4,4-trifluoro-1-(5-nitrothiophen-3-yl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171216694 |
| Molecular Formula | C8H10ClF3N2O2S |
| Molecular Weight | 290.69 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | (1R)-4,4,4-trifluoro-1-(5-nitrothiophen-3-yl)butan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](CCC(F)(F)F)c1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H9F3N2O2S.ClH/c9-8(10,11)2-1-6(12)5-3-7(13(14)15)16-4-5;/h3-4,6H,1-2,12H2;1H/t6-;/m1./s1 |
| InChIKey | LCGQGDRPXKHETA-FYZOBXCZSA-N |
| XLogP | 3.42 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.69 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|