C12H18Cl2F3N3O2S — CID 171304179
1-[(1R)-4,4,4-trifluoro-1-(5-nitrothiophen-3-yl)butyl]piperazine;dihydrochloride (PubChem CID 171304179) has the molecular formula C12H18Cl2F3N3O2S and a molecular weight of 396.26 g/mol. Its IUPAC name is 1-[(1R)-4,4,4-trifluoro-1-(5-nitrothiophen-3-yl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-4,4,4-trifluoro-1-(5-nitrothiophen-3-yl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171304179 |
| Molecular Formula | C12H18Cl2F3N3O2S |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 1-[(1R)-4,4,4-trifluoro-1-(5-nitrothiophen-3-yl)butyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1cc([C@@H](CCC(F)(F)F)N2CCNCC2)cs1 |
| InChI | InChI=1S/C12H16F3N3O2S.2ClH/c13-12(14,15)2-1-10(17-5-3-16-4-6-17)9-7-11(18(19)20)21-8-9;;/h7-8,10,16H,1-6H2;2*1H/t10-;;/m1../s1 |
| InChIKey | ROCXAFHZJIBXOI-YQFADDPSSA-N |
| XLogP | 3.79 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|