C12H18Cl2F3N3O3 — CID 171302323
1-[(1S)-4,4,4-trifluoro-1-(5-nitrofuran-2-yl)butyl]piperazine;dihydrochloride (PubChem CID 171302323) has the molecular formula C12H18Cl2F3N3O3 and a molecular weight of 380.19 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(5-nitrofuran-2-yl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(5-nitrofuran-2-yl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171302323 |
| Molecular Formula | C12H18Cl2F3N3O3 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(5-nitrofuran-2-yl)butyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccc([C@H](CCC(F)(F)F)N2CCNCC2)o1 |
| InChI | InChI=1S/C12H16F3N3O3.2ClH/c13-12(14,15)4-3-9(17-7-5-16-6-8-17)10-1-2-11(21-10)18(19)20;;/h1-2,9,16H,3-8H2;2*1H/t9-;;/m0../s1 |
| InChIKey | FHPXMVPRUWXQSY-WWPIYYJJSA-N |
| XLogP | 3.32 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|