C14H19Cl2F4N3O2 — CID 171303709
1-[(1R)-4,4,4-trifluoro-1-(4-fluoro-2-nitrophenyl)butyl]piperazine;dihydrochloride (PubChem CID 171303709) has the molecular formula C14H19Cl2F4N3O2 and a molecular weight of 408.22 g/mol. Its IUPAC name is 1-[(1R)-4,4,4-trifluoro-1-(4-fluoro-2-nitrophenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-4,4,4-trifluoro-1-(4-fluoro-2-nitrophenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171303709 |
| Molecular Formula | C14H19Cl2F4N3O2 |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 1-[(1R)-4,4,4-trifluoro-1-(4-fluoro-2-nitrophenyl)butyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1cc(F)ccc1[C@@H](CCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C14H17F4N3O2.2ClH/c15-10-1-2-11(13(9-10)21(22)23)12(3-4-14(16,17)18)20-7-5-19-6-8-20;;/h1-2,9,12,19H,3-8H2;2*1H/t12-;;/m1../s1 |
| InChIKey | RLFQAKDAMRSZOF-CURYUGHLSA-N |
| XLogP | 3.87 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|