C15H20Cl2F3N3O4 — CID 171302861
1-[(1S)-4,4,4-trifluoro-1-(6-nitro-1,3-benzodioxol-5-yl)butyl]piperazine;dihydrochloride (PubChem CID 171302861) has the molecular formula C15H20Cl2F3N3O4 and a molecular weight of 434.24 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(6-nitro-1,3-benzodioxol-5-yl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(6-nitro-1,3-benzodioxol-5-yl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171302861 |
| Molecular Formula | C15H20Cl2F3N3O4 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(6-nitro-1,3-benzodioxol-5-yl)butyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1cc2c(cc1[C@H](CCC(F)(F)F)N1CCNCC1)OCO2 |
| InChI | InChI=1S/C15H18F3N3O4.2ClH/c16-15(17,18)2-1-11(20-5-3-19-4-6-20)10-7-13-14(25-9-24-13)8-12(10)21(22)23;;/h7-8,11,19H,1-6,9H2;2*1H/t11-;;/m0../s1 |
| InChIKey | JEIZXDGSIZXMHD-IDMXKUIJSA-N |
| XLogP | 3.46 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|