C16H25Cl2N3O4 — CID 171292209
1-[(1R)-2,2-dimethyl-1-(6-nitro-1,3-benzodioxol-5-yl)propyl]piperazine;dihydrochloride (PubChem CID 171292209) has the molecular formula C16H25Cl2N3O4 and a molecular weight of 394.30 g/mol. Its IUPAC name is 1-[(1R)-2,2-dimethyl-1-(6-nitro-1,3-benzodioxol-5-yl)propyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2,2-dimethyl-1-(6-nitro-1,3-benzodioxol-5-yl)propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171292209 |
| Molecular Formula | C16H25Cl2N3O4 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[(1R)-2,2-dimethyl-1-(6-nitro-1,3-benzodioxol-5-yl)propyl]piperazine;dihydrochloride |
| SMILES | CC(C)(C)[C@H](c1cc2c(cc1[N+](=O)[O-])OCO2)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H23N3O4.2ClH/c1-16(2,3)15(18-6-4-17-5-7-18)11-8-13-14(23-10-22-13)9-12(11)19(20)21;;/h8-9,15,17H,4-7,10H2,1-3H3;2*1H/t15-;;/m0../s1 |
| InChIKey | VHXZKVPDYCSMGB-CKUXDGONSA-N |
| XLogP | 3.16 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|