C16H27Cl2N3O3 — CID 171301709
2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-6-methyl-3-nitrophenol;dihydrochloride (PubChem CID 171301709) has the molecular formula C16H27Cl2N3O3 and a molecular weight of 380.32 g/mol. Its IUPAC name is 2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-6-methyl-3-nitrophenol;dihydrochloride.
| Compound Name | 2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-6-methyl-3-nitrophenol;dihydrochloride |
|---|---|
| PubChem CID | 171301709 |
| Molecular Formula | C16H27Cl2N3O3 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-6-methyl-3-nitrophenol;dihydrochloride |
| SMILES | Cc1ccc([N+](=O)[O-])c([C@H](N2CCNCC2)C(C)(C)C)c1O.Cl.Cl |
| InChI | InChI=1S/C16H25N3O3.2ClH/c1-11-5-6-12(19(21)22)13(14(11)20)15(16(2,3)4)18-9-7-17-8-10-18;;/h5-6,15,17,20H,7-10H2,1-4H3;2*1H/t15-;;/m0../s1 |
| InChIKey | GCANPMRKAGHFBT-CKUXDGONSA-N |
| XLogP | 3.44 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|