C15H22ClN3O2 — CID 171278418
1-[(1S)-1-(5-chloro-2-nitrophenyl)-2,2-dimethylpropyl]piperazine (PubChem CID 171278418) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-nitrophenyl)-2,2-dimethylpropyl]piperazine.
| Compound Name | 1-[(1S)-1-(5-chloro-2-nitrophenyl)-2,2-dimethylpropyl]piperazine |
|---|---|
| PubChem CID | 171278418 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-nitrophenyl)-2,2-dimethylpropyl]piperazine |
| SMILES | CC(C)(C)[C@@H](c1cc(Cl)ccc1[N+](=O)[O-])N1CCNCC1 |
| InChI | InChI=1S/C15H22ClN3O2/c1-15(2,3)14(18-8-6-17-7-9-18)12-10-11(16)4-5-13(12)19(20)21/h4-5,10,14,17H,6-9H2,1-3H3/t14-/m1/s1 |
| InChIKey | WJMGLJBTVFZZFJ-CQSZACIVSA-N |
| XLogP | 3.24 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|