C14H20Cl3N3O2 — CID 171278399
1-[(S)-(5-chloro-2-nitrophenyl)-cyclopropylmethyl]piperazine;dihydrochloride (PubChem CID 171278399) has the molecular formula C14H20Cl3N3O2 and a molecular weight of 368.69 g/mol. Its IUPAC name is 1-[(S)-(5-chloro-2-nitrophenyl)-cyclopropylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(5-chloro-2-nitrophenyl)-cyclopropylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171278399 |
| Molecular Formula | C14H20Cl3N3O2 |
| Molecular Weight | 368.69 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 1-[(S)-(5-chloro-2-nitrophenyl)-cyclopropylmethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccc(Cl)cc1[C@H](C1CC1)N1CCNCC1 |
| InChI | InChI=1S/C14H18ClN3O2.2ClH/c15-11-3-4-13(18(19)20)12(9-11)14(10-1-2-10)17-7-5-16-6-8-17;;/h3-4,9-10,14,16H,1-2,5-8H2;2*1H/t14-;;/m0../s1 |
| InChIKey | QSHKCOPMLLACJS-UTLKBRERSA-N |
| XLogP | 3.45 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|