C13H16F4N2O — CID 171298401
3-fluoro-6-methyl-2-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol (PubChem CID 171298401) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is 3-fluoro-6-methyl-2-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol.
| Compound Name | 3-fluoro-6-methyl-2-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol |
|---|---|
| PubChem CID | 171298401 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-fluoro-6-methyl-2-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol |
| SMILES | Cc1ccc(F)c([C@@H](N2CCNCC2)C(F)(F)F)c1O |
| InChI | InChI=1S/C13H16F4N2O/c1-8-2-3-9(14)10(11(8)20)12(13(15,16)17)19-6-4-18-5-7-19/h2-3,12,18,20H,4-7H2,1H3/t12-/m1/s1 |
| InChIKey | RVJQCLCVYZLKEA-GFCCVEGCSA-N |
| XLogP | 2.35 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|