C17H27Cl2FN2O — CID 171300893
2-[(R)-cyclopentyl(piperazin-1-yl)methyl]-3-fluoro-6-methylphenol;dihydrochloride (PubChem CID 171300893) has the molecular formula C17H27Cl2FN2O and a molecular weight of 365.32 g/mol. Its IUPAC name is 2-[(R)-cyclopentyl(piperazin-1-yl)methyl]-3-fluoro-6-methylphenol;dihydrochloride.
| Compound Name | 2-[(R)-cyclopentyl(piperazin-1-yl)methyl]-3-fluoro-6-methylphenol;dihydrochloride |
|---|---|
| PubChem CID | 171300893 |
| Molecular Formula | C17H27Cl2FN2O |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[(R)-cyclopentyl(piperazin-1-yl)methyl]-3-fluoro-6-methylphenol;dihydrochloride |
| SMILES | Cc1ccc(F)c([C@@H](C2CCCC2)N2CCNCC2)c1O.Cl.Cl |
| InChI | InChI=1S/C17H25FN2O.2ClH/c1-12-6-7-14(18)15(17(12)21)16(13-4-2-3-5-13)20-10-8-19-9-11-20;;/h6-7,13,16,19,21H,2-5,8-11H2,1H3;2*1H/t16-;;/m1../s1 |
| InChIKey | QBBNJVIHDKZWMU-GGMCWBHBSA-N |
| XLogP | 3.82 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|