C17H26Cl2F2N2O — CID 171300095
2-[(R)-cyclohexyl(piperazin-1-yl)methyl]-3,6-difluorophenol;dihydrochloride (PubChem CID 171300095) has the molecular formula C17H26Cl2F2N2O and a molecular weight of 383.31 g/mol. Its IUPAC name is 2-[(R)-cyclohexyl(piperazin-1-yl)methyl]-3,6-difluorophenol;dihydrochloride.
| Compound Name | 2-[(R)-cyclohexyl(piperazin-1-yl)methyl]-3,6-difluorophenol;dihydrochloride |
|---|---|
| PubChem CID | 171300095 |
| Molecular Formula | C17H26Cl2F2N2O |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[(R)-cyclohexyl(piperazin-1-yl)methyl]-3,6-difluorophenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1c(F)ccc(F)c1[C@@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C17H24F2N2O.2ClH/c18-13-6-7-14(19)17(22)15(13)16(12-4-2-1-3-5-12)21-10-8-20-9-11-21;;/h6-7,12,16,20,22H,1-5,8-11H2;2*1H/t16-;;/m1../s1 |
| InChIKey | ZYQVHVMWCBDHAW-GGMCWBHBSA-N |
| XLogP | 4.04 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|