C16H22F2N2O2 — CID 171297619
3,6-difluoro-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol (PubChem CID 171297619) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3,6-difluoro-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol.
| Compound Name | 3,6-difluoro-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 171297619 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3,6-difluoro-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol |
| SMILES | Oc1c(F)ccc(F)c1[C@H](C1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H22F2N2O2/c17-12-1-2-13(18)16(21)14(12)15(11-3-9-22-10-4-11)20-7-5-19-6-8-20/h1-2,11,15,19,21H,3-10H2/t15-/m0/s1 |
| InChIKey | XSXQDYZJKGKLRC-HNNXBMFYSA-N |
| XLogP | 2.04 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|