C13H19F3N2O — CID 171303028
1-[(1S)-4,4,4-trifluoro-1-(5-methylfuran-2-yl)butyl]piperazine (PubChem CID 171303028) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(5-methylfuran-2-yl)butyl]piperazine.
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(5-methylfuran-2-yl)butyl]piperazine |
|---|---|
| PubChem CID | 171303028 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(5-methylfuran-2-yl)butyl]piperazine |
| SMILES | Cc1ccc([C@H](CCC(F)(F)F)N2CCNCC2)o1 |
| InChI | InChI=1S/C13H19F3N2O/c1-10-2-3-12(19-10)11(4-5-13(14,15)16)18-8-6-17-7-9-18/h2-3,11,17H,4-9H2,1H3/t11-/m0/s1 |
| InChIKey | YZYVBADEKLVGKJ-NSHDSACASA-N |
| XLogP | 2.88 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |