C9H11ClF2N2O4S — CID 171251949
ethyl (3S)-3-amino-2,2-difluoro-3-(5-nitrothiophen-3-yl)propanoate;hydrochloride (PubChem CID 171251949) has the molecular formula C9H11ClF2N2O4S and a molecular weight of 316.71 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2,2-difluoro-3-(5-nitrothiophen-3-yl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-2,2-difluoro-3-(5-nitrothiophen-3-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171251949 |
| Molecular Formula | C9H11ClF2N2O4S |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | ethyl (3S)-3-amino-2,2-difluoro-3-(5-nitrothiophen-3-yl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1csc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C9H10F2N2O4S.ClH/c1-2-17-8(14)9(10,11)7(12)5-3-6(13(15)16)18-4-5;/h3-4,7H,2,12H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | LRXQEJAAXGTNGG-FJXQXJEOSA-N |
| XLogP | 2.28 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|