C11H12Cl2F2N2O4 — CID 171241739
ethyl (3R)-3-amino-3-(4-chloro-3-nitrophenyl)-2,2-difluoropropanoate;hydrochloride (PubChem CID 171241739) has the molecular formula C11H12Cl2F2N2O4 and a molecular weight of 345.13 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(4-chloro-3-nitrophenyl)-2,2-difluoropropanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-3-(4-chloro-3-nitrophenyl)-2,2-difluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171241739 |
| Molecular Formula | C11H12Cl2F2N2O4 |
| Molecular Weight | 345.13 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | ethyl (3R)-3-amino-3-(4-chloro-3-nitrophenyl)-2,2-difluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@H](N)c1ccc(Cl)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C11H11ClF2N2O4.ClH/c1-2-20-10(17)11(13,14)9(15)6-3-4-7(12)8(5-6)16(18)19;/h3-5,9H,2,15H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | BNHVMSKGEBVKKU-SBSPUUFOSA-N |
| XLogP | 2.87 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|