C11H11ClF2N2O4 — CID 171241884
ethyl (3R)-3-amino-3-(2-chloro-5-nitrophenyl)-2,2-difluoropropanoate (PubChem CID 171241884) has the molecular formula C11H11ClF2N2O4 and a molecular weight of 308.67 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(2-chloro-5-nitrophenyl)-2,2-difluoropropanoate.
| Compound Name | ethyl (3R)-3-amino-3-(2-chloro-5-nitrophenyl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 171241884 |
| Molecular Formula | C11H11ClF2N2O4 |
| Molecular Weight | 308.67 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | ethyl (3R)-3-amino-3-(2-chloro-5-nitrophenyl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@H](N)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C11H11ClF2N2O4/c1-2-20-10(17)11(13,14)9(15)7-5-6(16(18)19)3-4-8(7)12/h3-5,9H,2,15H2,1H3/t9-/m1/s1 |
| InChIKey | DWMSKFVSGMEPLP-SECBINFHSA-N |
| XLogP | 2.45 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|