C8H6ClF3N2O2 — CID 77128404
1-(2-chloro-5-nitrophenyl)-2,2,2-trifluoroethanamine (PubChem CID 77128404) has the molecular formula C8H6ClF3N2O2 and a molecular weight of 254.59 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-2,2,2-trifluoroethanamine.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 77128404 |
| Molecular Formula | C8H6ClF3N2O2 |
| Molecular Weight | 254.59 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-2,2,2-trifluoroethanamine |
| SMILES | NC(c1cc([N+](=O)[O-])ccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C8H6ClF3N2O2/c9-6-2-1-4(14(15)16)3-5(6)7(13)8(10,11)12/h1-3,7H,13H2 |
| InChIKey | KEXVTWPYVCCXAI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|