C9H10Cl2F2N2O3 — CID 171241895
(3R)-3-amino-3-(2-chloro-5-nitrophenyl)-2,2-difluoropropan-1-ol;hydrochloride (PubChem CID 171241895) has the molecular formula C9H10Cl2F2N2O3 and a molecular weight of 303.09 g/mol. Its IUPAC name is (3R)-3-amino-3-(2-chloro-5-nitrophenyl)-2,2-difluoropropan-1-ol;hydrochloride.
| Compound Name | (3R)-3-amino-3-(2-chloro-5-nitrophenyl)-2,2-difluoropropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171241895 |
| Molecular Formula | C9H10Cl2F2N2O3 |
| Molecular Weight | 303.09 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | (3R)-3-amino-3-(2-chloro-5-nitrophenyl)-2,2-difluoropropan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H](c1cc([N+](=O)[O-])ccc1Cl)C(F)(F)CO |
| InChI | InChI=1S/C9H9ClF2N2O3.ClH/c10-7-2-1-5(14(16)17)3-6(7)8(13)9(11,12)4-15;/h1-3,8,15H,4,13H2;1H/t8-;/m1./s1 |
| InChIKey | RRLIOPPHEYTZTK-DDWIOCJRSA-N |
| XLogP | 2.30 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.09 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|