C8H7ClF3N3O2 — CID 66512272
4-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-chloro-2-nitroaniline (PubChem CID 66512272) has the molecular formula C8H7ClF3N3O2 and a molecular weight of 269.61 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-chloro-2-nitroaniline.
| Compound Name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-chloro-2-nitroaniline |
|---|---|
| PubChem CID | 66512272 |
| Molecular Formula | C8H7ClF3N3O2 |
| Molecular Weight | 269.61 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-chloro-2-nitroaniline |
| SMILES | Nc1cc(Cl)c([C@H](N)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7ClF3N3O2/c9-4-2-5(13)6(15(16)17)1-3(4)7(14)8(10,11)12/h1-2,7H,13-14H2/t7-/m0/s1 |
| InChIKey | GBFLKUHQTHGTDD-ZETCQYMHSA-N |
| XLogP | 2.39 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|