C8H7ClF2N2O3 — CID 147350893
4-chloro-5-(2,2-difluoroethoxy)-2-nitroaniline (PubChem CID 147350893) has the molecular formula C8H7ClF2N2O3 and a molecular weight of 252.60 g/mol. Its IUPAC name is 4-chloro-5-(2,2-difluoroethoxy)-2-nitroaniline.
| Compound Name | 4-chloro-5-(2,2-difluoroethoxy)-2-nitroaniline |
|---|---|
| PubChem CID | 147350893 |
| Molecular Formula | C8H7ClF2N2O3 |
| Molecular Weight | 252.60 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 4-chloro-5-(2,2-difluoroethoxy)-2-nitroaniline |
| SMILES | Nc1cc(OCC(F)F)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7ClF2N2O3/c9-4-1-6(13(14)15)5(12)2-7(4)16-3-8(10)11/h1-2,8H,3,12H2 |
| InChIKey | DFJGAOLWCXISIY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.60 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|