C12H4Cl4N2O5 — CID 57162217
1,4-dichloro-2-(2,5-dichloro-4-nitrophenoxy)-5-nitrobenzene (PubChem CID 57162217) has the molecular formula C12H4Cl4N2O5 and a molecular weight of 397.99 g/mol. Its IUPAC name is 1,4-dichloro-2-(2,5-dichloro-4-nitrophenoxy)-5-nitrobenzene.
| Compound Name | 1,4-dichloro-2-(2,5-dichloro-4-nitrophenoxy)-5-nitrobenzene |
|---|---|
| PubChem CID | 57162217 |
| Molecular Formula | C12H4Cl4N2O5 |
| Molecular Weight | 397.99 g/mol |
| Exact Mass | 395.89 |
| IUPAC Name | 1,4-dichloro-2-(2,5-dichloro-4-nitrophenoxy)-5-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Oc2cc(Cl)c([N+](=O)[O-])cc2Cl)cc1Cl |
| InChI | InChI=1S/C12H4Cl4N2O5/c13-5-3-11(7(15)1-9(5)17(19)20)23-12-4-6(14)10(18(21)22)2-8(12)16/h1-4H |
| InChIKey | GGVROISYJKXGIX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|