C9H11Cl2NO3Si — CID 167719977
(2,5-dichloro-4-nitrophenoxy)-trimethylsilane (PubChem CID 167719977) has the molecular formula C9H11Cl2NO3Si and a molecular weight of 280.18 g/mol. Its IUPAC name is (2,5-dichloro-4-nitrophenoxy)-trimethylsilane.
| Compound Name | (2,5-dichloro-4-nitrophenoxy)-trimethylsilane |
|---|---|
| PubChem CID | 167719977 |
| Molecular Formula | C9H11Cl2NO3Si |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | (2,5-dichloro-4-nitrophenoxy)-trimethylsilane |
| SMILES | C[Si](C)(C)Oc1cc(Cl)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C9H11Cl2NO3Si/c1-16(2,3)15-9-5-6(10)8(12(13)14)4-7(9)11/h4-5H,1-3H3 |
| InChIKey | AAULTWNIAONMAT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|