C9H12ClNO5 — CID 174813767
1-chloro-2,5-dimethoxy-4-nitrobenzene;methanol (PubChem CID 174813767) has the molecular formula C9H12ClNO5 and a molecular weight of 249.65 g/mol. Its IUPAC name is 1-chloro-2,5-dimethoxy-4-nitrobenzene;methanol.
| Compound Name | 1-chloro-2,5-dimethoxy-4-nitrobenzene;methanol |
|---|---|
| PubChem CID | 174813767 |
| Molecular Formula | C9H12ClNO5 |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1-chloro-2,5-dimethoxy-4-nitrobenzene;methanol |
| SMILES | CO.COc1cc([N+](=O)[O-])c(OC)cc1Cl |
| InChI | InChI=1S/C8H8ClNO4.CH4O/c1-13-7-4-6(10(11)12)8(14-2)3-5(7)9;1-2/h3-4H,1-2H3;2H,1H3 |
| InChIKey | NXKCDOCOPWVFRP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|