C7H7NO5 — CID 86249066
4-methoxy-5-nitrobenzene-1,2-diol (PubChem CID 86249066) has the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. Its IUPAC name is 4-methoxy-5-nitrobenzene-1,2-diol.
| Compound Name | 4-methoxy-5-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 86249066 |
| Molecular Formula | C7H7NO5 |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 4-methoxy-5-nitrobenzene-1,2-diol |
| SMILES | COc1cc(O)c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7NO5/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3,9-10H,1H3 |
| InChIKey | UZVBZFJJWNUIIE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|