C7H6N2O5S — CID 101493596
5-methoxy-2,4-dinitrobenzenethiol (PubChem CID 101493596) has the molecular formula C7H6N2O5S and a molecular weight of 230.20 g/mol. Its IUPAC name is 5-methoxy-2,4-dinitrobenzenethiol.
| Compound Name | 5-methoxy-2,4-dinitrobenzenethiol |
|---|---|
| PubChem CID | 101493596 |
| Molecular Formula | C7H6N2O5S |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 5-methoxy-2,4-dinitrobenzenethiol |
| SMILES | COc1cc(S)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6N2O5S/c1-14-6-3-7(15)5(9(12)13)2-4(6)8(10)11/h2-3,15H,1H3 |
| InChIKey | CKQJLKOPYBHKHQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|