C8H6N4O9 — CID 23423952
1-(dinitromethyl)-5-methoxy-2,4-dinitrobenzene (PubChem CID 23423952) has the molecular formula C8H6N4O9 and a molecular weight of 302.16 g/mol. Its IUPAC name is 1-(dinitromethyl)-5-methoxy-2,4-dinitrobenzene.
| Compound Name | 1-(dinitromethyl)-5-methoxy-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 23423952 |
| Molecular Formula | C8H6N4O9 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 1-(dinitromethyl)-5-methoxy-2,4-dinitrobenzene |
| SMILES | COc1cc(C([N+](=O)[O-])[N+](=O)[O-])c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6N4O9/c1-21-7-2-4(8(11(17)18)12(19)20)5(9(13)14)3-6(7)10(15)16/h2-3,8H,1H3 |
| InChIKey | JCNNMVJAXPTORD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 181.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|