About 5-amino-2,4-dinitrobenzenethiol
5-amino-2,4-dinitrobenzenethiol (PubChem CID 88541379) has the molecular formula C6H5N3O4S
and a molecular weight of 215.19 g/mol. Its IUPAC name is 5-amino-2,4-dinitrobenzenethiol.
Molecular Properties
| Compound Name | 5-amino-2,4-dinitrobenzenethiol |
| PubChem CID | 88541379 |
| Molecular Formula | C6H5N3O4S |
| Molecular Weight | 215.19 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | 5-amino-2,4-dinitrobenzenethiol |
| SMILES | Nc1cc(S)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5N3O4S/c7-3-1-6(14)5(9(12)13)2-4(3)8(10)11/h1-2,14H,7H2 |
| InChIKey | UYIRYKUUXHPAAB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,4-dinitrobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,4-dinitrobenzenethiol?
The IUPAC name of 5-amino-2,4-dinitrobenzenethiol (CID 88541379) is 5-amino-2,4-dinitrobenzenethiol.
What is the SMILES notation for 5-amino-2,4-dinitrobenzenethiol?
The canonical SMILES for 5-amino-2,4-dinitrobenzenethiol is Nc1cc(S)c([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 5-amino-2,4-dinitrobenzenethiol?
The InChIKey is UYIRYKUUXHPAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O4S/c7-3-1-6(14)5(9(12)13)2-4(3)8(10)11/h1-2,14H,7H2.
What are the key properties of 5-amino-2,4-dinitrobenzenethiol?
5-amino-2,4-dinitrobenzenethiol has a molecular weight of 215.19 g/mol, XLogP of 1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,4-dinitrobenzenethiol is sourced from PubChem (CID 88541379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).