C8H8N4O4 — CID 146673880
4-amino-5-nitrobenzene-1,2-dicarboxamide (PubChem CID 146673880) has the molecular formula C8H8N4O4 and a molecular weight of 224.18 g/mol. Its IUPAC name is 4-amino-5-nitrobenzene-1,2-dicarboxamide.
| Compound Name | 4-amino-5-nitrobenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 146673880 |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 4-amino-5-nitrobenzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1cc(N)c([N+](=O)[O-])cc1C(N)=O |
| InChI | InChI=1S/C8H8N4O4/c9-5-1-3(7(10)13)4(8(11)14)2-6(5)12(15)16/h1-2H,9H2,(H2,10,13)(H2,11,14) |
| InChIKey | AKUGYLJQQVZSKY-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 155.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|