C7H4Cl2N2O3 — CID 69073651
4,5-dichloro-2-nitrobenzamide (PubChem CID 69073651) has the molecular formula C7H4Cl2N2O3 and a molecular weight of 235.03 g/mol. Its IUPAC name is 4,5-dichloro-2-nitrobenzamide.
| Compound Name | 4,5-dichloro-2-nitrobenzamide |
|---|---|
| PubChem CID | 69073651 |
| Molecular Formula | C7H4Cl2N2O3 |
| Molecular Weight | 235.03 g/mol |
| Exact Mass | 233.96 |
| IUPAC Name | 4,5-dichloro-2-nitrobenzamide |
| SMILES | NC(=O)c1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4Cl2N2O3/c8-4-1-3(7(10)12)6(11(13)14)2-5(4)9/h1-2H,(H2,10,12) |
| InChIKey | YVUKUHREDBWHLJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.03 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|