C13H8N4O5 — CID 88596221
2,7-diamino-3,6-dinitrofluoren-9-one (PubChem CID 88596221) has the molecular formula C13H8N4O5 and a molecular weight of 300.23 g/mol. Its IUPAC name is 2,7-diamino-3,6-dinitrofluoren-9-one.
| Compound Name | 2,7-diamino-3,6-dinitrofluoren-9-one |
|---|---|
| PubChem CID | 88596221 |
| Molecular Formula | C13H8N4O5 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2,7-diamino-3,6-dinitrofluoren-9-one |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])-c1cc([N+](=O)[O-])c(N)cc1C2=O |
| InChI | InChI=1S/C13H8N4O5/c14-9-1-7-5(3-11(9)16(19)20)6-4-12(17(21)22)10(15)2-8(6)13(7)18/h1-4H,14-15H2 |
| InChIKey | HBUBUMDZCADMMX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|