C14H11N3O4 — CID 625211
3,7-dinitro-9,10-dihydrophenanthren-2-amine (PubChem CID 625211) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 3,7-dinitro-9,10-dihydrophenanthren-2-amine.
| Compound Name | 3,7-dinitro-9,10-dihydrophenanthren-2-amine |
|---|---|
| PubChem CID | 625211 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3,7-dinitro-9,10-dihydrophenanthren-2-amine |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])-c1ccc([N+](=O)[O-])cc1CC2 |
| InChI | InChI=1S/C14H11N3O4/c15-13-6-9-2-1-8-5-10(16(18)19)3-4-11(8)12(9)7-14(13)17(20)21/h3-7H,1-2,15H2 |
| InChIKey | CPIKCNDCGKOEII-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|