C9H8N2O3 — CID 122491074
(NE)-N-(5-nitro-2,3-dihydroinden-1-ylidene)hydroxylamine (PubChem CID 122491074) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is (NE)-N-(5-nitro-2,3-dihydroinden-1-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(5-nitro-2,3-dihydroinden-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 122491074 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (NE)-N-(5-nitro-2,3-dihydroinden-1-ylidene)hydroxylamine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CC/C2=N\O |
| InChI | InChI=1S/C9H8N2O3/c12-10-9-4-1-6-5-7(11(13)14)2-3-8(6)9/h2-3,5,12H,1,4H2/b10-9+ |
| InChIKey | RSPJBPMDOSROAZ-MDZDMXLPSA-N |
| XLogP | 1.72 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|