C11H12N2O3 — CID 142095043
(NE)-N-(2,2-dimethyl-6-nitro-3H-inden-1-ylidene)hydroxylamine (PubChem CID 142095043) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is (NE)-N-(2,2-dimethyl-6-nitro-3H-inden-1-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(2,2-dimethyl-6-nitro-3H-inden-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 142095043 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (NE)-N-(2,2-dimethyl-6-nitro-3H-inden-1-ylidene)hydroxylamine |
| SMILES | CC1(C)Cc2ccc([N+](=O)[O-])cc2/C1=N/O |
| InChI | InChI=1S/C11H12N2O3/c1-11(2)6-7-3-4-8(13(15)16)5-9(7)10(11)12-14/h3-5,14H,6H2,1-2H3/b12-10- |
| InChIKey | JTHZLQWBDPMKDE-BENRWUELSA-N |
| XLogP | 2.36 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|