C14H11NO2 — CID 614448
3-nitro-9,10-dihydrophenanthrene (PubChem CID 614448) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-nitro-9,10-dihydrophenanthrene.
| Compound Name | 3-nitro-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 614448 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-nitro-9,10-dihydrophenanthrene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)-c1ccccc1CC2 |
| InChI | InChI=1S/C14H11NO2/c16-15(17)12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-4,7-9H,5-6H2 |
| InChIKey | MNKKMDDRNPXSSA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|