C15H16 — CID 174728506
9,10-dihydrophenanthrene;methane (PubChem CID 174728506) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is 9,10-dihydrophenanthrene;methane.
| Compound Name | 9,10-dihydrophenanthrene;methane |
|---|---|
| PubChem CID | 174728506 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 9,10-dihydrophenanthrene;methane |
| SMILES | C.c1ccc2c(c1)CCc1ccccc1-2 |
| InChI | InChI=1S/C14H12.CH4/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;/h1-8H,9-10H2;1H4 |
| InChIKey | PWTPVELFJMGGEQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |