C14H12 — CID 175927057
10,10-dideuterio-9H-phenanthrene (PubChem CID 175927057) has the molecular formula C14H12 and a molecular weight of 182.26 g/mol. Its IUPAC name is 10,10-dideuterio-9H-phenanthrene.
| Compound Name | 10,10-dideuterio-9H-phenanthrene |
|---|---|
| PubChem CID | 175927057 |
| Molecular Formula | C14H12 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 10,10-dideuterio-9H-phenanthrene |
| SMILES | [2H]C1([2H])Cc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H12/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-8H,9-10H2/i9D2 |
| InChIKey | XXPBFNVKTVJZKF-KNXIQCGSSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |