About chromium;9H-fluorene
chromium;9H-fluorene (PubChem CID 161167703) has the molecular formula C13H10Cr
and a molecular weight of 218.22 g/mol. Its IUPAC name is chromium;9H-fluorene.
Molecular Properties
| Compound Name | chromium;9H-fluorene |
| PubChem CID | 161167703 |
| Molecular Formula | C13H10Cr |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | chromium;9H-fluorene |
| SMILES | [Cr].c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.Cr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;/h1-8H,9H2; |
| InChIKey | UQTPCAJQHWAADU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chromium;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;9H-fluorene?
The IUPAC name of chromium;9H-fluorene (CID 161167703) is chromium;9H-fluorene.
What is the SMILES notation for chromium;9H-fluorene?
The canonical SMILES for chromium;9H-fluorene is [Cr].c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of chromium;9H-fluorene?
The InChIKey is UQTPCAJQHWAADU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.Cr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;/h1-8H,9H2;.
What are the key properties of chromium;9H-fluorene?
chromium;9H-fluorene has a molecular weight of 218.22 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;9H-fluorene is sourced from PubChem (CID 161167703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).