About bis(9H-fluorene);azide
bis(9H-fluorene);azide (PubChem CID 22003430) has the molecular formula C26H20N3-
and a molecular weight of 374.47 g/mol. Its IUPAC name is bis(9H-fluorene);azide.
Molecular Properties
| Compound Name | bis(9H-fluorene);azide |
| PubChem CID | 22003430 |
| Molecular Formula | C26H20N3- |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | bis(9H-fluorene);azide |
| SMILES | [N-]=[N+]=[N-].c1ccc2c(c1)Cc1ccccc1-2.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/2C13H10.N3/c2*1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-2/h2*1-8H,9H2;/q;;-1 |
| InChIKey | LOEDWFPTNMWHFM-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze bis(9H-fluorene);azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(9H-fluorene);azide?
The IUPAC name of bis(9H-fluorene);azide (CID 22003430) is bis(9H-fluorene);azide.
What is the SMILES notation for bis(9H-fluorene);azide?
The canonical SMILES for bis(9H-fluorene);azide is [N-]=[N+]=[N-].c1ccc2c(c1)Cc1ccccc1-2.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of bis(9H-fluorene);azide?
The InChIKey is LOEDWFPTNMWHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H10.N3/c2*1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-2/h2*1-8H,9H2;/q;;-1.
What are the key properties of bis(9H-fluorene);azide?
bis(9H-fluorene);azide has a molecular weight of 374.47 g/mol, XLogP of 7.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(9H-fluorene);azide is sourced from PubChem (CID 22003430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).