About 9H-fluorene;oxophosphane
9H-fluorene;oxophosphane (PubChem CID 174601741) has the molecular formula C13H11OP
and a molecular weight of 214.20 g/mol. Its IUPAC name is 9H-fluorene;oxophosphane.
Molecular Properties
| Compound Name | 9H-fluorene;oxophosphane |
| PubChem CID | 174601741 |
| Molecular Formula | C13H11OP |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 9H-fluorene;oxophosphane |
| SMILES | O=P.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.HOP/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2/h1-8H,9H2;2H |
| InChIKey | GUQNHKXPNUBZLT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluorene;oxophosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;oxophosphane?
The IUPAC name of 9H-fluorene;oxophosphane (CID 174601741) is 9H-fluorene;oxophosphane.
What is the SMILES notation for 9H-fluorene;oxophosphane?
The canonical SMILES for 9H-fluorene;oxophosphane is O=P.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;oxophosphane?
The InChIKey is GUQNHKXPNUBZLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.HOP/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2/h1-8H,9H2;2H.
What are the key properties of 9H-fluorene;oxophosphane?
9H-fluorene;oxophosphane has a molecular weight of 214.20 g/mol, XLogP of 3.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;oxophosphane is sourced from PubChem (CID 174601741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).