About 9H-fluorene;formic acid
9H-fluorene;formic acid (PubChem CID 175878260) has the molecular formula C17H18O8
and a molecular weight of 350.32 g/mol. Its IUPAC name is 9H-fluorene;formic acid.
Molecular Properties
| Compound Name | 9H-fluorene;formic acid |
| PubChem CID | 175878260 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 9H-fluorene;formic acid |
| SMILES | O=CO.O=CO.O=CO.O=CO.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.4CH2O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;4*2-1-3/h1-8H,9H2;4*1H,(H,2,3) |
| InChIKey | MBTMSMBBYPNKHG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluorene;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;formic acid?
The IUPAC name of 9H-fluorene;formic acid (CID 175878260) is 9H-fluorene;formic acid.
What is the SMILES notation for 9H-fluorene;formic acid?
The canonical SMILES for 9H-fluorene;formic acid is O=CO.O=CO.O=CO.O=CO.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;formic acid?
The InChIKey is MBTMSMBBYPNKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.4CH2O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;4*2-1-3/h1-8H,9H2;4*1H,(H,2,3).
What are the key properties of 9H-fluorene;formic acid?
9H-fluorene;formic acid has a molecular weight of 350.32 g/mol, XLogP of 2.06, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;formic acid is sourced from PubChem (CID 175878260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).