About 9H-fluorene;trihydrofluoride
9H-fluorene;trihydrofluoride (PubChem CID 172854917) has the molecular formula C13H13F3
and a molecular weight of 226.24 g/mol. Its IUPAC name is 9H-fluorene;trihydrofluoride.
Molecular Properties
| Compound Name | 9H-fluorene;trihydrofluoride |
| PubChem CID | 172854917 |
| Molecular Formula | C13H13F3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 9H-fluorene;trihydrofluoride |
| SMILES | F.F.F.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.3FH/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;;;/h1-8H,9H2;3*1H |
| InChIKey | YOILEQQYWQHTCH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9H-fluorene;trihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;trihydrofluoride?
The IUPAC name of 9H-fluorene;trihydrofluoride (CID 172854917) is 9H-fluorene;trihydrofluoride.
What is the SMILES notation for 9H-fluorene;trihydrofluoride?
The canonical SMILES for 9H-fluorene;trihydrofluoride is F.F.F.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;trihydrofluoride?
The InChIKey is YOILEQQYWQHTCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.3FH/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;;;/h1-8H,9H2;3*1H.
What are the key properties of 9H-fluorene;trihydrofluoride?
9H-fluorene;trihydrofluoride has a molecular weight of 226.24 g/mol, XLogP of 3.72, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;trihydrofluoride is sourced from PubChem (CID 172854917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).