About 9H-fluorene;sulfane;hydrate
9H-fluorene;sulfane;hydrate (PubChem CID 159057499) has the molecular formula C13H14OS
and a molecular weight of 218.32 g/mol. Its IUPAC name is 9H-fluorene;sulfane;hydrate.
Molecular Properties
| Compound Name | 9H-fluorene;sulfane;hydrate |
| PubChem CID | 159057499 |
| Molecular Formula | C13H14OS |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 9H-fluorene;sulfane;hydrate |
| SMILES | O.S.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.H2O.H2S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;;/h1-8H,9H2;2*1H2 |
| InChIKey | WPEBSVHCCNGWJX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9H-fluorene;sulfane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;sulfane;hydrate?
The IUPAC name of 9H-fluorene;sulfane;hydrate (CID 159057499) is 9H-fluorene;sulfane;hydrate.
What is the SMILES notation for 9H-fluorene;sulfane;hydrate?
The canonical SMILES for 9H-fluorene;sulfane;hydrate is O.S.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;sulfane;hydrate?
The InChIKey is WPEBSVHCCNGWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.H2O.H2S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;;/h1-8H,9H2;2*1H2.
What are the key properties of 9H-fluorene;sulfane;hydrate?
9H-fluorene;sulfane;hydrate has a molecular weight of 218.32 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;sulfane;hydrate is sourced from PubChem (CID 159057499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).